4-(4-Methyl-5-thiazolyl)benzonitrile - CAS 122957-57-7
Catalog: |
BB005608 |
Product Name: |
4-(4-Methyl-5-thiazolyl)benzonitrile |
CAS: |
122957-57-7 |
Synonyms: |
4-(4-methyl-5-thiazolyl)benzonitrile; 4-(4-methyl-1,3-thiazol-5-yl)benzonitrile |
IUPAC Name: | 4-(4-methyl-1,3-thiazol-5-yl)benzonitrile |
Description: | 4-(4-Methyl-5-thiazolyl)benzonitrile (CAS# 122957-57-7) is a useful research chemical. |
Molecular Weight: | 200.26 |
Molecular Formula: | C11H8N2S |
Canonical SMILES: | CC1=C(SC=N1)C2=CC=C(C=C2)C#N |
InChI: | InChI=1S/C11H8N2S/c1-8-11(14-7-13-8)10-4-2-9(6-12)3-5-10/h2-5,7H,1H3 |
InChI Key: | REUDLMVWBUGLDA-UHFFFAOYSA-N |
MDL: | MFCD29041978 |
LogP: | 2.99018 |
Publication Number | Title | Priority Date |
WO-2021077010-A1 | Bifunctional molecules containing an e3 ubiquitine ligase binding moiety linked to a bcl6 targeting moiety | 20191017 |
WO-2021011913-A1 | Tau-protein targeting compounds and associated methods of use | 20190717 |
WO-2020264490-A1 | Irak degraders and uses thereof | 20190628 |
WO-2020113233-A1 | Irak degraders and uses thereof | 20181130 |
CN-113423427-A | IRAK degrading agents and uses thereof | 20181130 |
Complexity: | 237 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 200.04081944 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 200.04081944 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 64.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS