4-(4-Fluorophenyl)butyryl Chloride - CAS 133188-66-6
Catalog: |
BB007704 |
Product Name: |
4-(4-Fluorophenyl)butyryl Chloride |
CAS: |
133188-66-6 |
Synonyms: |
4-(4-fluorophenyl)butanoyl chloride; 4-(4-fluorophenyl)butanoyl chloride |
IUPAC Name: | 4-(4-fluorophenyl)butanoyl chloride |
Description: | 4-(4-Fluorophenyl)butyryl Chloride (CAS# 133188-66-6) is a useful research chemical. |
Molecular Weight: | 200.64 |
Molecular Formula: | C10H10ClFO |
Canonical SMILES: | C1=CC(=CC=C1CCCC(=O)Cl)F |
InChI: | InChI=1S/C10H10ClFO/c11-10(13)3-1-2-8-4-6-9(12)7-5-8/h4-7H,1-3H2 |
InChI Key: | OKGHRPHMHBMWMD-UHFFFAOYSA-N |
LogP: | 2.91380 |
Publication Number | Title | Priority Date |
WO-2016019588-A1 | Oxacazone compounds to treat clostridium difficile | 20140808 |
CN-101044116-A | 4-phenylsulfonamidopiperidines as calcium channel blockers | 20041014 |
US-6124284-A | Bicyclic amide derivatives and their use as muscle relaxants | 19980716 |
EP-0759025-A1 | Amide derivatives and their therapeutic use | 19940510 |
EP-0759025-B1 | Amide derivatives and their therapeutic use | 19940510 |
Complexity: | 164 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 200.0404208 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 200.0404208 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 17.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS