4-(4-Bromophenyl)tetrahydropyran-4-ol - CAS 165119-46-0
Catalog: |
BB012170 |
Product Name: |
4-(4-Bromophenyl)tetrahydropyran-4-ol |
CAS: |
165119-46-0 |
Synonyms: |
4-(4-bromophenyl)-4-oxanol; 4-(4-bromophenyl)oxan-4-ol |
IUPAC Name: | 4-(4-bromophenyl)oxan-4-ol |
Description: | 4-(4-Bromophenyl)tetrahydropyran-4-ol (CAS# 165119-46-0) is a useful research chemical. |
Molecular Weight: | 257.12 |
Molecular Formula: | C11H13BrO2 |
Canonical SMILES: | C1COCCC1(C2=CC=C(C=C2)Br)O |
InChI: | InChI=1S/C11H13BrO2/c12-10-3-1-9(2-4-10)11(13)5-7-14-8-6-11/h1-4,13H,5-8H2 |
InChI Key: | FMPWAQRTCKMZKN-UHFFFAOYSA-N |
LogP: | 2.44710 |
Publication Number | Title | Priority Date |
CN-113072546-A | Five-membered heteroaromatic derivative and preparation method and application thereof | 20200106 |
AU-2017208119-A1 | 6,7,8,9-tetrahydro-5H-pyrido[2,3-d]azepine dopamine D3 ligands | 20160115 |
AU-2017208119-B2 | 6,7,8,9-tetrahydro-5H-pyrido[2,3-d]azepine dopamine D3 ligands | 20160115 |
EP-3402796-A1 | 6,7,8,9-TETRAHYDRO-5H-PYRIDO[2,3-d]AZEPINE DOPAMINE D3 LIGANDS | 20160115 |
RU-2712455-C1 | 6,7,8,9-tetrahydro-5h-pyrido[2,3-d]azepine ligands of dopamine receptors d3 | 20160115 |
Complexity: | 182 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 256.00989 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 256.00989 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 29.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS