4-(4-Bromophenoxy)benzaldehyde - CAS 69240-56-8
Catalog: |
BB033743 |
Product Name: |
4-(4-Bromophenoxy)benzaldehyde |
CAS: |
69240-56-8 |
Synonyms: |
4-(4-bromophenoxy)benzaldehyde |
IUPAC Name: | 4-(4-bromophenoxy)benzaldehyde |
Description: | 4-(4-Bromophenoxy)benzaldehyde (CAS# 69240-56-8) is a useful research chemical. |
Molecular Weight: | 277.11 |
Molecular Formula: | C13H9BrO2 |
Canonical SMILES: | C1=CC(=CC=C1C=O)OC2=CC=C(C=C2)Br |
InChI: | InChI=1S/C13H9BrO2/c14-11-3-7-13(8-4-11)16-12-5-1-10(9-15)2-6-12/h1-9H |
InChI Key: | WMDDJOBNAOVSLP-UHFFFAOYSA-N |
Boiling Point: | 364.712 ℃ at 760 mmHg |
Melting Point: | 69-73 ℃ |
Purity: | 95 % |
Density: | 1.475 g/cm3 |
Appearance: | White to brown solid |
MDL: | MFCD08276811 |
LogP: | 4.05390 |
GHS Hazard Statement: | H317 (97.67%): May cause an allergic skin reaction [Warning Sensitization, Skin] |
Precautionary Statement: | P261, P272, P280, P302+P352, P305+P351+P338, P310, P321, P333+P313, P363, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
EP-3523292-A1 | Heteroaryl compounds and their use as mer inhibitors | 20161010 |
US-2019315716-A1 | Heteroaryl compounds and their use as mer inhibitors | 20161010 |
WO-2018071343-A1 | Heteroaryl compounds and their use as mer inhibitors | 20161010 |
US-10913730-B2 | Heteroaryl compounds and their use as Mer inhibitors | 20161010 |
US-2014121213-A1 | Voltage-gated sodium channel blockers | 20110706 |
Complexity: | 216 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 275.97859 |
Formal Charge: | 0 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 275.97859 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 26.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS