4-(4-Bromo-2-fluorophenyl)morpholine - CAS 513068-89-8
Catalog: |
BB027400 |
Product Name: |
4-(4-Bromo-2-fluorophenyl)morpholine |
CAS: |
513068-89-8 |
Synonyms: |
4-(4-bromo-2-fluorophenyl)morpholine; 4-(4-bromo-2-fluorophenyl)morpholine |
IUPAC Name: | 4-(4-bromo-2-fluorophenyl)morpholine |
Description: | 4-(4-Bromo-2-fluorophenyl)morpholine used in the synthesis of oxazolidinone antibacterials. |
Molecular Weight: | 260.10 |
Molecular Formula: | C10H11BrFNO |
Canonical SMILES: | C1COCCN1C2=C(C=C(C=C2)Br)F |
InChI: | InChI=1S/C10H11BrFNO/c11-8-1-2-10(9(12)7-8)13-3-5-14-6-4-13/h1-2,7H,3-6H2 |
InChI Key: | LJQJHWZLMLYPJV-UHFFFAOYSA-N |
LogP: | 2.48980 |
Publication Number | Title | Priority Date |
WO-2020163689-A1 | 20-hete formation inhibitors | 20190208 |
WO-2019233883-A1 | Tetrahydrobenzofuro[2,3-c]pyridine and beta-carboline compounds for the treatment, alleviation or prevention of disorders associated with tau aggregates | 20180604 |
US-2021267989-A1 | Novel Compounds for the Treatment, Alleviation or Prevention of Disorders Associated with Tau Aggregates | 20180604 |
AU-2017361099-A1 | Anthelmintic depsipeptide compounds | 20161116 |
BR-112019009977-A2 | anthelmintic depsipeptide compounds | 20161116 |
Complexity: | 187 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 259.0008 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 259.0008 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 12.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Morpholines/Thiomorpholines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS