4-[4-(Aminomethyl)benzyl]morpholine - CAS 91271-84-0
Catalog: |
BB040101 |
Product Name: |
4-[4-(Aminomethyl)benzyl]morpholine |
CAS: |
91271-84-0 |
Synonyms: |
[4-(4-morpholinylmethyl)phenyl]methanamine; [4-(morpholin-4-ylmethyl)phenyl]methanamine |
IUPAC Name: | [4-(morpholin-4-ylmethyl)phenyl]methanamine |
Description: | 4-[4-(Aminomethyl)benzyl]morpholine (CAS# 91271-84-0) is a useful research chemical. |
Molecular Weight: | 206.28 |
Molecular Formula: | C12H18N2O |
Canonical SMILES: | C1COCCN1CC2=CC=C(C=C2)CN |
InChI: | InChI=1S/C12H18N2O/c13-9-11-1-3-12(4-2-11)10-14-5-7-15-8-6-14/h1-4H,5-10,13H2 |
InChI Key: | OTMQHFNPBREFIL-UHFFFAOYSA-N |
Boiling Point: | 324.7 °C at 760 mmHg |
Density: | 1.103 g/cm3 |
MDL: | MFCD05664410 |
LogP: | 1.61570 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P310, P312, P321, P330, P332+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
TW-202000674-A | Fused thiophene compounds | 20180613 |
US-2020000814-A1 | Fused thiophene compounds | 20180613 |
WO-2019241271-A1 | Fused thiophene compounds | 20180613 |
AU-2019284605-A1 | Fused thiophene compounds | 20180613 |
EP-3807283-A1 | Fused thiophene compounds | 20180613 |
Complexity: | 173 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 206.141913202 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 206.141913202 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 38.5 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS