4-(3-Chlorophenyl)-2-pyrrolidone - CAS 357338-16-0
Catalog: |
BB022748 |
Product Name: |
4-(3-Chlorophenyl)-2-pyrrolidone |
CAS: |
357338-16-0 |
Synonyms: |
4-(3-chlorophenyl)-2-pyrrolidinone; 4-(3-chlorophenyl)pyrrolidin-2-one |
IUPAC Name: | 4-(3-chlorophenyl)pyrrolidin-2-one |
Description: | 4-(3-Chlorophenyl)-2-pyrrolidone (CAS# 357338-16-0) is a useful research chemical. |
Molecular Weight: | 195.65 |
Molecular Formula: | C10H10ClNO |
Canonical SMILES: | C1C(CNC1=O)C2=CC(=CC=C2)Cl |
InChI: | InChI=1S/C10H10ClNO/c11-9-3-1-2-7(4-9)8-5-10(13)12-6-8/h1-4,8H,5-6H2,(H,12,13) |
InChI Key: | YGKWZVARCHRFLH-UHFFFAOYSA-N |
LogP: | 2.27230 |
Publication Number | Title | Priority Date |
TW-200538435-A | (2S)-2-[4-(2, 2-difluorovinyl)-2-oxopyrrolidin-1-yl]butanoic acids and their uses | 20010313 |
TW-200538436-A | (2S)-2-[(4s)-4-(2, 2-difluorovinyl)-2-oxopyrrolidin-1-yl]butanamides and their uses | 20010313 |
TW-200538437-A | (2S)-2-[2-oxo-4-propylpyrrolidinyl]butanamides and their uses | 20010313 |
TW-I295286-B | (2s)-2-[(2-oxo-4-propylpyrrolidinyl)butanamides and their uses | 20010313 |
TW-I297682-B | 2-oxo-1-pyrrolidine derivatives, processes for preparing them and their uses | 20010313 |
Complexity: | 207 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 195.0450916 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 195.0450916 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 29.1 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS