4-(2-Chloroethoxy)nitrobenzene - CAS 3383-72-0
Catalog: |
BB021849 |
Product Name: |
4-(2-Chloroethoxy)nitrobenzene |
CAS: |
3383-72-0 |
Synonyms: |
1-(2-chloroethoxy)-4-nitrobenzene; 1-(2-chloroethoxy)-4-nitrobenzene |
IUPAC Name: | 1-(2-chloroethoxy)-4-nitrobenzene |
Description: | 4-(2-Chloroethoxy)nitrobenzene (CAS# 3383-72-0) is a useful research chemical. |
Molecular Weight: | 201.61 |
Molecular Formula: | C8H8ClNO3 |
Canonical SMILES: | C1=CC(=CC=C1[N+](=O)[O-])OCCCl |
InChI: | InChI=1S/C8H8ClNO3/c9-5-6-13-8-3-1-7(2-4-8)10(11)12/h1-4H,5-6H2 |
InChI Key: | OBCFOPGCTNULTG-UHFFFAOYSA-N |
Boiling Point: | 332.1 °C at 760 mmHg |
Density: | 1.316 g/cm3 |
MDL: | MFCD00674505 |
LogP: | 2.73560 |
GHS Hazard Statement: | H315 (56.52%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P272, P273, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P333+P313, P337+P313, P362, P363, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-109593064-A | Dithiocarbamates compound as BTK inhibitor | 20181128 |
CN-109593064-B | Dithiocarbamate compounds as BTK inhibitors | 20181128 |
EP-3395795-A1 | Malononitrile oxime ether compound and use thereof | 20151225 |
US-10544092-B2 | Malononitrile oxime ether compound and use thereof | 20151225 |
US-2018362450-A1 | Malononitrile oxime ether compound and use thereof | 20151225 |
Complexity: | 163 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 201.0192708 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 201.0192708 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 55 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS