4-(1-Phenylvinyl)morpholine - CAS 7196-01-2
Catalog: |
BB034506 |
Product Name: |
4-(1-Phenylvinyl)morpholine |
CAS: |
7196-01-2 |
Synonyms: |
4-(1-phenylethenyl)morpholine |
IUPAC Name: | 4-(1-phenylethenyl)morpholine |
Description: | 4-(1-Phenylvinyl)morpholine (CAS# 7196-01-2 ) is a useful research chemical. |
Molecular Weight: | 189.25 |
Molecular Formula: | C12H15NO |
Canonical SMILES: | C=C(C1=CC=CC=C1)N2CCOCC2 |
InChI: | InChI=1S/C12H15NO/c1-11(12-5-3-2-4-6-12)13-7-9-14-10-8-13/h2-6H,1,7-10H2 |
InChI Key: | DRLPQHUSIRTYBM-UHFFFAOYSA-N |
LogP: | 1.92740 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P322, P330, P332+P313, P337+P313, P362, P363, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
EP-3760607-A1 | Method for converting n,n-dialkylamide compound into ester compound using complex of fourth-period transition metal as catalyst | 20180228 |
EP-1419163-A1 | Tricyclic imidazopyridines | 20010810 |
EP-1419163-B1 | Tricyclic imidazopyridines | 20010810 |
EP-1419163-B9 | Tricyclic imidazopyridines | 20010810 |
US-2005049272-A1 | Tricyclic imidazopyridines | 20010810 |
Complexity: | 191 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 189.115364102 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 189.115364102 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 12.5 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Morpholines/Thiomorpholines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS