4-(1,4-Dioxaspiro[4.5]decan-8-yl)cyclohexanone - CAS 56309-94-5
Catalog: |
BB029324 |
Product Name: |
4-(1,4-Dioxaspiro[4.5]decan-8-yl)cyclohexanone |
CAS: |
56309-94-5 |
Synonyms: |
4-(1,4-dioxaspiro[4.5]decan-8-yl)-1-cyclohexanone; 4-(1,4-dioxaspiro[4.5]decan-8-yl)cyclohexan-1-one |
IUPAC Name: | 4-(1,4-dioxaspiro[4.5]decan-8-yl)cyclohexan-1-one |
Description: | 4-(1,4-Dioxaspiro[4.5]decan-8-yl)cyclohexanone (CAS# 56309-94-5) is a useful research chemical. |
Molecular Weight: | 238.32 |
Molecular Formula: | C14H22O3 |
Canonical SMILES: | C1CC(=O)CCC1C2CCC3(CC2)OCCO3 |
InChI: | InChI=1S/C14H22O3/c15-13-3-1-11(2-4-13)12-5-7-14(8-6-12)16-9-10-17-14/h11-12H,1-10H2 |
InChI Key: | ZNWLFTSPNBLXGL-UHFFFAOYSA-N |
Boiling Point: | 365.4 ℃ at 760 mmHg |
Density: | 1.11 g/cm3 |
MDL: | MFCD00809704 |
LogP: | 2.67900 |
GHS Hazard Statement: | H317: May cause an allergic skin reaction [Warning Sensitization, Skin] |
Precautionary Statement: | P261, P272, P273, P280, P302+P352, P321, P333+P313, P363, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-110862430-A | Preparation method of 5 α -androstane-3, 17-dione | 20191206 |
WO-2019225614-A1 | Resist underlayer film-forming composition using cyclic carbonyl compound | 20180525 |
KR-20210013040-A | Composition for forming a resist underlayer film using a cyclic carbonyl compound | 20180525 |
US-2021124268-A1 | Resist underlayer film-forming composition including cyclic carbonyl compound | 20180525 |
JP-WO2019225614-A1 | Resist underlayer film forming composition using a cyclic carbonyl compound | 20180525 |
PMID | Publication Date | Title | Journal |
12098304 | 20020712 | An efficient route for the preparation of a 21-fluoro progestin-16 alpha,17 alpha-dioxolane, a high-affinity ligand for PET imaging of the progesterone receptor | The Journal of organic chemistry |
Complexity: | 274 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 238.15689456 |
Formal Charge: | 0 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 238.15689456 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 35.5 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS