3H-Benzo[c][1,2]dithiol-3-one - CAS 1677-27-6
Catalog: |
BB012413 |
Product Name: |
3H-Benzo[c][1,2]dithiol-3-one |
CAS: |
1677-27-6 |
Synonyms: |
1,2-benzodithiol-3-one; 1,2-benzodithiol-3-one |
IUPAC Name: | 1,2-benzodithiol-3-one |
Description: | 3H-Benzo[c][1,2]dithiol-3-one (CAS# 1677-27-6 ) is a useful research chemical. |
Molecular Weight: | 168.24 |
Molecular Formula: | C7H4OS2 |
Canonical SMILES: | C1=CC=C2C(=C1)C(=O)SS2 |
InChI: | InChI=1S/C7H4OS2/c8-7-5-3-1-2-4-6(5)9-10-7/h1-4H |
InChI Key: | GZTYTTPPCAXUHB-UHFFFAOYSA-N |
Appearance: | Yellow crystalline |
MDL: | MFCD00134412 |
LogP: | 2.32300 |
Publication Number | Title | Priority Date |
WO-2021177438-A1 | Antibody-drug conjugate including novel cyclic dinucleotide derivative | 20200306 |
CN-110950836-A | Preparation method of benzodithiol heterocyclic alkene skeleton compound | 20191213 |
WO-2021039935-A1 | Nucleic acid compound manufacturing method and nucleic acid compound | 20190829 |
WO-2021013234-A1 | Cyclic dinucleotides as sting agonists | 20190725 |
WO-2020229982-A1 | Antibody drug conjugates | 20190510 |
PMID | Publication Date | Title | Journal |
20204198 | 20100321 | Thiol-dependent DNA cleavage by aminomethylated Beaucage's reagent | Organic & biomolecular chemistry |
19319857 | 20090301 | Solid-supported reagents for synthesis of nucleoside monothiophosphates, dithiodiphosphates, and trithiotriphosphates | Current protocols in nucleic acid chemistry |
18068362 | 20080515 | Possible chemical mechanisms underlying the antitumor activity of S-deoxyleinamycin | Bioorganic & medicinal chemistry letters |
16095328 | 20050819 | Substituent effects on the reactivity of benzo-1,2-dithiolan-3-one 1-oxides and their possible application to the synthesis of DNA-targeting drugs | The Journal of organic chemistry |
Complexity: | 158 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 167.97035709 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 167.97035709 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 67.7 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Other Building Blocks
Customers Also Viewed
-
[56507-37-0]
Metribuzin-diketo
-
[33229-34-4]
2,2'-[4-(2-Hydroxyethylamino)-3-nitrophenylimino]diethanol
-
[132182-92-4]
Pentane, 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)-
-
[279-23-2]
Norbornane
-
[70406-92-7]
N-(6-Amino-2,3-dichlorobenzyl)glycine ethyl ester
-
[883-44-3]
N-(3-Hydroxypropyl)phthalimide
INDUSTRY LEADERS TRUST OUR PRODUCTS