(3-Phenoxypropyl)hydrazine Dihydrochloride - CAS 1808112-54-0
Catalog: |
BB013762 |
Product Name: |
(3-Phenoxypropyl)hydrazine Dihydrochloride |
CAS: |
1808112-54-0 |
Synonyms: |
3-phenoxypropylhydrazine;dihydrochloride; 3-phenoxypropylhydrazine;dihydrochloride |
IUPAC Name: | 3-phenoxypropylhydrazine;dihydrochloride |
Description: | (3-Phenoxypropyl)hydrazine Dihydrochloride (CAS# 1808112-54-0 ) is a useful research chemical. |
Molecular Weight: | 239.14 |
Molecular Formula: | C9H16Cl2N2O |
Canonical SMILES: | C1=CC=C(C=C1)OCCCNN.Cl.Cl |
InChI: | InChI=1S/C9H14N2O.2ClH/c10-11-7-4-8-12-9-5-2-1-3-6-9;;/h1-3,5-6,11H,4,7-8,10H2;2*1H |
InChI Key: | DIHXJVIGLIJJDX-UHFFFAOYSA-N |
Publication Number | Title | Priority Date |
AU-2015226881-A1 | Inhibitors of histone lysine specific demethylase (LSD1) and histone deacetylases (HDACs) | 20140307 |
CA-2941716-A1 | Inhibitors of histone lysine specific demethylase (lsd1) and histone deacetylases (hdacs) | 20140307 |
CN-106458856-A | Inhibitors of histone lysine specific demethylase (lsd1) and histone deacetylases (hdacs) | 20140307 |
EP-3114109-A1 | Inhibitors of histone lysine specific demethylase (lsd1) and histone deacetylases (hdacs) | 20140307 |
JP-2017508798-A | Inhibitors of histone lysine specific demethylase (LSD1) and histone deacetylase (HDAC) | 20140307 |
Complexity: | 103 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 3 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 238.0639685 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 4 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 238.0639685 |
Rotatable Bond Count: | 5 |
Topological Polar Surface Area: | 47.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS