3-Oxo-7-azaspiro[3.5]nonane-7-carboxylate tert-butyl ester - CAS 849203-60-7
Catalog: |
BB037370 |
Product Name: |
3-Oxo-7-azaspiro[3.5]nonane-7-carboxylate tert-butyl ester |
CAS: |
849203-60-7 |
Synonyms: |
tert-butyl 3-oxo-7-azaspiro[3.5]nonane-7-carboxylate |
IUPAC Name: | tert-butyl 3-oxo-7-azaspiro[3.5]nonane-7-carboxylate |
Description: | 3-Oxo-7-azaspiro[3.5]nonane-7-carboxylate tert-butyl ester (CAS# 849203-60-7) is a useful research chemical. |
Molecular Weight: | 239.31 |
Molecular Formula: | C13H21NO3 |
Canonical SMILES: | CC(C)(C)OC(=O)N1CCC2(CCC2=O)CC1 |
InChI: | InChI=1S/C13H21NO3/c1-12(2,3)17-11(16)14-8-6-13(7-9-14)5-4-10(13)15/h4-9H2,1-3H3 |
InChI Key: | IJUALTPNDJIBJT-UHFFFAOYSA-N |
Purity: | 95+ % |
Appearance: | Solid |
MDL: | MFCD14585368 |
LogP: | 2.30450 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2020100959-A1 | 1,3,4-oxadiazolone compound and medicine | 20181115 |
CN-113302184-A | 1,3, 4-oxadiazolinone compounds and drugs | 20181115 |
EP-3882239-A1 | 1,3,4-oxadiazolone compound and medicine | 20181115 |
JP-WO2020100959-A1 | 1,3,4-oxadiazolone compounds and pharmaceuticals | 20181115 |
KR-20210091767-A | 1,3,4-oxadiazolone compounds and medicaments | 20181115 |
Complexity: | 335 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 239.15214353 |
Formal Charge: | 0 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 239.15214353 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 46.6 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS