3-(Methylsulfonylamino)benzylamine Hydrochloride - CAS 238428-26-7
Catalog: |
BB018204 |
Product Name: |
3-(Methylsulfonylamino)benzylamine Hydrochloride |
CAS: |
238428-26-7 |
Synonyms: |
N-[3-(aminomethyl)phenyl]methanesulfonamide;hydrochloride; N-[3-(aminomethyl)phenyl]methanesulfonamide;hydrochloride |
IUPAC Name: | N-[3-(aminomethyl)phenyl]methanesulfonamide;hydrochloride |
Description: | 3-(Methylsulfonylamino)benzylamine Hydrochloride (CAS# 238428-26-7) is a useful research chemical. |
Molecular Weight: | 236.72 |
Molecular Formula: | C8H13ClN2O2S |
Canonical SMILES: | CS(=O)(=O)NC1=CC=CC(=C1)CN.Cl |
InChI: | InChI=1S/C8H12N2O2S.ClH/c1-13(11,12)10-8-4-2-3-7(5-8)6-9;/h2-5,10H,6,9H2,1H3;1H |
InChI Key: | QRQYQHPUXNPLOG-UHFFFAOYSA-N |
Boiling Point: | 380.9 °C at 760 mmHg |
MDL: | MFCD09054706 |
LogP: | 3.17290 |
Publication Number | Title | Priority Date |
EP-2684468-A1 | Salty taste enhancer | 20110307 |
JP-WO2012121273-A1 | Salt enhancer | 20110307 |
US-2014004243-A1 | Salty taste enhancer | 20110307 |
WO-2012121273-A1 | Salty taste enhancer | 20110307 |
AU-2011328904-A1 | Agonists that enhance binding of integrin-expressing cells to integrin receptors | 20101116 |
Complexity: | 245 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 236.0386265 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 3 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 236.0386265 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 80.6 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS