(3-methyloxetan-3-yl)methanamine - CAS 153209-97-3
Catalog: |
BB010865 |
Product Name: |
(3-methyloxetan-3-yl)methanamine |
CAS: |
153209-97-3 |
Synonyms: |
(3-methyl-3-oxetanyl)methanamine; (3-methyloxetan-3-yl)methanamine |
IUPAC Name: | (3-methyloxetan-3-yl)methanamine |
Description: | (3-methyloxetan-3-yl)methanamine (CAS# 153209-97-3) is a useful research chemical. |
Molecular Weight: | 101.149 |
Molecular Formula: | C5H11NO |
Canonical SMILES: | CC1(COC1)CN |
InChI: | InChI=1S/C5H11NO/c1-5(2-6)3-7-4-5/h2-4,6H2,1H3 |
InChI Key: | MCPRXSXYXHMCKF-UHFFFAOYSA-N |
Boiling Point: | 134.473 °C at 760 mmHg |
Density: | 0.962 g/cm3 |
MDL: | MFCD08703640 |
LogP: | 0.68190 |
GHS Hazard Statement: | H226 (97.56%): Flammable liquid and vapor [Warning Flammable liquids] |
Precautionary Statement: | P210, P233, P240, P241, P242, P243, P264, P270, P280, P301+P312, P303+P361+P353, P330, P370+P378, P403+P235, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021212039-A1 | Inhibitors of cysteine proteases and methods of use thereof | 20200417 |
WO-2021180235-A1 | Inhibitor of enhancer of zeste homologue 2, and use thereof | 20200313 |
WO-2021130259-A1 | Dihydrocyclopenta-isoquinoline-sulfonamide derivatives compounds | 20191223 |
WO-2021066088-A1 | Novel triazine derivative | 20191002 |
WO-2021067326-A1 | Substituted bicyclic heteroaryl compounds | 20191001 |
Complexity: | 68.5 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 101.084063974 |
Formal Charge: | 0 |
Heavy Atom Count: | 7 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 101.084063974 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 35.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Oxetane/Thietane
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS