3-Methylisoxazol-5(4H)-one morpholine salt - CAS 67823-26-1
Catalog: |
BB033406 |
Product Name: |
3-Methylisoxazol-5(4H)-one morpholine salt |
CAS: |
67823-26-1 |
Synonyms: |
3-methyl-4H-1,2-oxazol-5-one;morpholine |
IUPAC Name: | 3-methyl-4H-1,2-oxazol-5-one;morpholine |
Description: | 3-Methylisoxazol-5(4H)-one morpholine salt (CAS# 67823-26-1 ) is a useful research chemical. |
Molecular Weight: | 186.21 |
Molecular Formula: | C8H14N2O3 |
Canonical SMILES: | CC1=NOC(=O)C1.C1COCCN1 |
InChI: | InChI=1S/C4H5NO2.C4H9NO/c1-3-2-4(6)7-5-3;1-3-6-4-2-5-1/h2H2,1H3;5H,1-4H2 |
InChI Key: | UNTXTXCRCQLVPT-UHFFFAOYSA-N |
Boiling Point: | 119.1 °C at 760 mmHg |
MDL: | MFCD00042999 |
LogP: | -0.32020 |
Publication Number | Title | Priority Date |
EP-1062360-A1 | Compositions and methods for enhanced synthesis of nucleic acid molecules | 19980313 |
JP-2002505886-A | Compositions and methods for enhancing the synthesis of nucleic acid molecules | 19980313 |
US-2004265969-A1 | Compositions and methods for enhanced synthesis of nucleic acid molecules | 19980313 |
US-6787305-B1 | Compositions and methods for enhanced synthesis of nucleic acid molecules | 19980313 |
US-7344863-B2 | Methods for producing polypeptides through enhanced synthesis of encoding nucleic acid molecules | 19980313 |
Complexity: | 162 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 186.10044231 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 186.10044231 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 59.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Isoxazoles
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS