3-Methylindene-2-carboxylic acid - CAS 34225-81-5
Catalog: |
BB022014 |
Product Name: |
3-Methylindene-2-carboxylic acid |
CAS: |
34225-81-5 |
Synonyms: |
3-methyl-1H-indene-2-carboxylic acid |
IUPAC Name: | 3-methyl-1H-indene-2-carboxylic acid |
Description: | 3-Methylindene-2-carboxylic acid (CAS# 34225-81-5) is a useful research chemical compound. |
Molecular Weight: | 174.20 |
Molecular Formula: | C11H10O2 |
Canonical SMILES: | CC1=C(CC2=CC=CC=C12)C(=O)O |
InChI: | InChI=1S/C11H10O2/c1-7-9-5-3-2-4-8(9)6-10(7)11(12)13/h2-5H,6H2,1H3,(H,12,13) |
InChI Key: | RONBYWGSEXDEKC-UHFFFAOYSA-N |
Boiling Point: | 306.9 ℃ at 760 mmHg |
Density: | 1.243 g/cm3 |
MDL: | MFCD00044428 |
LogP: | 2.10080 |
Publication Number | Title | Priority Date |
WO-2021119554-A1 | Compositions and methods for potentiating immune activity | 20191212 |
EP-3523292-A1 | Heteroaryl compounds and their use as mer inhibitors | 20161010 |
US-2019315716-A1 | Heteroaryl compounds and their use as mer inhibitors | 20161010 |
WO-2018071343-A1 | Heteroaryl compounds and their use as mer inhibitors | 20161010 |
US-10913730-B2 | Heteroaryl compounds and their use as Mer inhibitors | 20161010 |
Complexity: | 265 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 174.068079557 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 174.068079557 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 37.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS