3-Methyl-3H-imidazo[4,5-b]pyridin-6-ol - CAS 1171920-70-9
Catalog: |
BB003897 |
Product Name: |
3-Methyl-3H-imidazo[4,5-b]pyridin-6-ol |
CAS: |
1171920-70-9 |
Synonyms: |
3-methylimidazo[4,5-b]pyridin-6-ol |
IUPAC Name: | 3-methylimidazo[4,5-b]pyridin-6-ol |
Description: | 3-Methyl-3H-imidazo[4,5-b]pyridin-6-ol (CAS# 1171920-70-9) is a useful research chemical. |
Molecular Weight: | 149.15 |
Molecular Formula: | C7H7N3O |
Canonical SMILES: | CN1C=NC2=CC(=CN=C21)O |
InChI: | InChI=1S/C7H7N3O/c1-10-4-9-6-2-5(11)3-8-7(6)10/h2-4,11H,1H3 |
InChI Key: | DBOOZEZYJOGVFG-UHFFFAOYSA-N |
Purity: | 95 % |
MDL: | MFCD12401667 |
LogP: | 0.67390 |
Publication Number | Title | Priority Date |
TW-201329067-A | Urea compound as a GKA activator | 20111208 |
EP-2590944-A1 | 1-phenyl-substituted heterocyclyl derivatives and their use as prostaglandin d2 receptor modulators | 20100705 |
EP-2590944-B1 | 1-phenyl-substituted heterocyclyl derivatives and their use as prostaglandin d2 receptor modulators | 20100705 |
US-2013109685-A1 | 1-phenyl-substituted heterocyclyl derivatives and their use as prostaglandin d2 receptor modulators | 20100705 |
US-8575158-B2 | 1-phenyl-substituted heterocyclyl derivatives and their use as prostaglandin D2 receptor modulators | 20100705 |
Complexity: | 153 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 149.058911855 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 149.058911855 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 50.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS