3-Methyl-3H-imidazo[4,5-b]pyridin-6-amine - CAS 1186310-95-1
Catalog: |
BB004176 |
Product Name: |
3-Methyl-3H-imidazo[4,5-b]pyridin-6-amine |
CAS: |
1186310-95-1 |
Synonyms: |
3-methylimidazo[4,5-b]pyridin-6-amine |
IUPAC Name: | 3-methylimidazo[4,5-b]pyridin-6-amine |
Description: | 3-Methyl-3H-imidazo[4,5-b]pyridin-6-amine (CAS# 1186310-95-1) is useful in the preparation of Pyrrolo[1,2-b]pyridazine derivatives as IRAK4 inhibitors. |
Molecular Weight: | 148.17 |
Molecular Formula: | C7H8N4 |
Canonical SMILES: | CN1C=NC2=CC(=CN=C21)N |
InChI: | InChI=1S/C7H8N4/c1-11-4-10-6-2-5(8)3-9-7(6)11/h2-4H,8H2,1H3 |
InChI Key: | KMNNVCWSIWTUSL-UHFFFAOYSA-N |
Purity: | 95 % |
LogP: | 1.13170 |
Publication Number | Title | Priority Date |
US-10398783-B2 | Antiproliferative compounds and conjugates made therefrom | 20161020 |
US-2018110873-A1 | Antiproliferative compounds and conjugates made therefrom | 20161020 |
US-2019358339-A1 | Antiproliferative compounds and conjugates made therefrom | 20161020 |
US-10869934-B2 | Antiproliferative compounds and conjugates made therefrom | 20161020 |
CN-109689664-A | The quinoline and azepine quinoline compound that tricyclic heteroaryl as PAR4 inhibitor replaces | 20160714 |
Complexity: | 149 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 148.074896272 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 148.074896272 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 56.7 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS