3-Iodobenzyloxybenzene - CAS 107623-21-2
Catalog: |
BB002111 |
Product Name: |
3-Iodobenzyloxybenzene |
CAS: |
107623-21-2 |
Synonyms: |
1-iodo-3-phenylmethoxybenzene |
IUPAC Name: | 1-iodo-3-phenylmethoxybenzene |
Description: | 3-Iodobenzyloxybenzene (CAS# 107623-21-2) is a useful research chemical. |
Molecular Weight: | 310.13 |
Molecular Formula: | C13H11IO |
Canonical SMILES: | C1=CC=C(C=C1)COC2=CC(=CC=C2)I |
InChI: | InChI=1S/C13H11IO/c14-12-7-4-8-13(9-12)15-10-11-5-2-1-3-6-11/h1-9H,10H2 |
InChI Key: | QMKHOPJXDQAHBG-UHFFFAOYSA-N |
Boiling Point: | 369.7 °C at 760 mmHg |
Melting Point: | 47-50 °C |
Purity: | 95 % |
Density: | 1.58 g/cm3 |
Appearance: | Solid |
MDL: | MFCD01318100 |
LogP: | 3.87020 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021203014-A1 | Pyrano[4,3-b]l ndole derivatives as alpha-1 -antitrypsin modulators for treating alpha-1 -antitrypsin deficiency (aatd) | 20200403 |
WO-2020247429-A1 | Pyrrolidine compounds | 20190607 |
JP-2021524498-A | Pyrrolidine compound | 20190607 |
JP-6940717-B2 | Pyrrolidine compound | 20190607 |
US-2021253559-A1 | Pyrrolidine compounds | 20190607 |
PMID | Publication Date | Title | Journal |
18454143 | 20080601 | Gene expression signatures and small-molecule compounds link a protein kinase to Plasmodium falciparum motility | Nature chemical biology |
Complexity: | 177 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 309.98546 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 309.98546 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 9.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 4.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Oxygen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS