3-Hydroxycyclopentanecarbaldehyde - CAS 69492-90-6
Catalog: |
BB033847 |
Product Name: |
3-Hydroxycyclopentanecarbaldehyde |
CAS: |
69492-90-6 |
Synonyms: |
3-hydroxy-1-cyclopentanecarboxaldehyde; 3-hydroxycyclopentane-1-carbaldehyde |
IUPAC Name: | 3-hydroxycyclopentane-1-carbaldehyde |
Description: | 3-Hydroxycyclopentanecarbaldehyde (CAS# 69492-90-6 ) is a useful research chemical. |
Molecular Weight: | 114.14 |
Molecular Formula: | C6H10O2 |
Canonical SMILES: | C1CC(CC1C=O)O |
InChI: | InChI=1S/C6H10O2/c7-4-5-1-2-6(8)3-5/h4-6,8H,1-3H2 |
InChI Key: | FWKGSDVDYSPDMF-UHFFFAOYSA-N |
LogP: | 0.34630 |
Publication Number | Title | Priority Date |
US-2008103125-A1 | Heterocylic antiviral compounds | 20060918 |
US-7625905-B2 | Octahydro-pyrrolo[3,4-c]pyrrole CCR5 receptor antagonists | 20060918 |
WO-2008034731-A1 | Octahydropyrrolo [3, 4-c] pyrrole derivatives an their use as antiviral agents | 20060918 |
US-2004039208-A1 | Process for making n-aryl-anthranilic acids and their derivatives | 20010720 |
EP-1313694-A1 | Process for making n-aryl-anthranilic acids and their derivatives | 20000825 |
Complexity: | 90.5 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 114.068079557 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 114.068079557 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 37.3 |
Undefined Atom Stereocenter Count: | 2 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS