3-Hydroxy-6-(8-hydroxy-1,4-dioxaspiro[4.5]decan-8-yl)pyridine - CAS 713526-59-1
Catalog: |
BB034364 |
Product Name: |
3-Hydroxy-6-(8-hydroxy-1,4-dioxaspiro[4.5]decan-8-yl)pyridine |
CAS: |
713526-59-1 |
Synonyms: |
6-(8-hydroxy-1,4-dioxaspiro[4.5]decan-8-yl)-3-pyridinol; 6-(8-hydroxy-1,4-dioxaspiro[4.5]decan-8-yl)pyridin-3-ol |
IUPAC Name: | 6-(8-hydroxy-1,4-dioxaspiro[4.5]decan-8-yl)pyridin-3-ol |
Description: | 3-Hydroxy-6-(8-hydroxy-1,4-dioxaspiro[4.5]decan-8-yl)pyridine (CAS# 713526-59-1 ) is a useful research chemical. |
Molecular Weight: | 251.28 |
Molecular Formula: | C13H17NO4 |
Canonical SMILES: | C1CC2(CCC1(C3=NC=C(C=C3)O)O)OCCO2 |
InChI: | InChI=1S/C13H17NO4/c15-10-1-2-11(14-9-10)12(16)3-5-13(6-4-12)17-7-8-18-13/h1-2,9,15-16H,3-8H2 |
InChI Key: | ISTKQVXMPAEOKX-UHFFFAOYSA-N |
LogP: | 1.29190 |
Publication Number | Title | Priority Date |
EP-2862856-A1 | Aromatic heterocyclic compound | 20120615 |
EP-2862856-B1 | Imidazole and triazole compounds as dgat-1 inhibitors | 20120615 |
US-10308636-B2 | Aromatic heterocyclic compound | 20120615 |
US-2015158844-A1 | Aromatic heterocyclic compound | 20120615 |
US-2017050950-A1 | Aromatic heterocyclic compound | 20120615 |
Complexity: | 293 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 251.11575802 |
Formal Charge: | 0 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 251.11575802 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 71.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS