3-formylfuran-2-carboxylic acid - CAS 29182-07-8
Catalog: |
BB020121 |
Product Name: |
3-formylfuran-2-carboxylic acid |
CAS: |
29182-07-8 |
Synonyms: |
3-formyl-2-furancarboxylic acid; 3-formylfuran-2-carboxylic acid |
IUPAC Name: | 3-formylfuran-2-carboxylic acid |
Description: | 3-formylfuran-2-carboxylic acid (CAS# 29182-07-8 ) is a useful research chemical. |
Molecular Weight: | 140.094 |
Molecular Formula: | C6H4O4 |
Canonical SMILES: | C1=COC(=C1C=O)C(=O)O |
InChI: | InChI=1S/C6H4O4/c7-3-4-1-2-10-5(4)6(8)9/h1-3H,(H,8,9) |
InChI Key: | ICRNLRSCBXVFAL-UHFFFAOYSA-N |
LogP: | 0.79030 |
Publication Number | Title | Priority Date |
WO-2021195953-A1 | Method for preparing 2,5-furandicarboxylic acid | 20200331 |
WO-2021123240-A1 | Process for the synthesis of 2,5-furandicarboxylic acid | 20191220 |
WO-2021124354-A1 | A process for the synthesis of furandicarboxylic acid | 20191219 |
WO-2021106230-A1 | Novel phenol compound or salt thereof | 20191129 |
WO-2020190043-A1 | Method for producing 5-alkoxy-methylfurfural and 2,5-furandicarboxylic acid from fructose | 20190321 |
Complexity: | 154 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 140.0109586 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 140.0109586 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 67.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Furans
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS