3-Fluoroazetidine-1-ethanamine - CAS 2045189-35-1
Catalog: |
BB015984 |
Product Name: |
3-Fluoroazetidine-1-ethanamine |
CAS: |
2045189-35-1 |
Synonyms: |
2-(3-fluoro-1-azetidinyl)ethanamine; 2-(3-fluoroazetidin-1-yl)ethanamine |
IUPAC Name: | 2-(3-fluoroazetidin-1-yl)ethanamine |
Description: | 3-Fluoroazetidine-1-ethanamine (CAS# 2045189-35-1 ) is a useful research chemical. |
Molecular Weight: | 118.15 |
Molecular Formula: | C5H11FN2 |
Canonical SMILES: | C1C(CN1CCN)F |
InChI: | InChI=1S/C5H11FN2/c6-5-3-8(4-5)2-1-7/h5H,1-4,7H2 |
InChI Key: | ZVOBAJVTRLDBGM-UHFFFAOYSA-N |
Publication Number | Title | Priority Date |
US-2016333009-A1 | Benzimidazole and imadazopyridine carboximidamide compounds | 20150515 |
US-9951065-B2 | Benzimidazole and imadazopyridine carboximidamide compounds | 20150515 |
WO-2014023367-A1 | Carboxamide or sulfonamide substituted nitrogen-containing 5-membered heterocycles as modulators for the orphan nuclear receptor ror gamma | 20120809 |
US-2015175562-A1 | Carboxamide or sulfonamide substituted thiazoles and related derivatives as modulators for the orphan nuclear receptor ror[gamma] | 20120531 |
WO-2013178362-A1 | Carboxamide or sulfonamide substituted thiazoles and related derivatives as modulators for the orphan nuclear receptor ror[gamma] | 20120531 |
Complexity: | 70.8 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 118.09062652 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 118.09062652 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 29.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Azetidines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS