3-Fluoro-5-iodobenzonitrile - CAS 723294-75-5
Catalog: |
BB034604 |
Product Name: |
3-Fluoro-5-iodobenzonitrile |
CAS: |
723294-75-5 |
Synonyms: |
3-fluoro-5-iodobenzonitrile; 3-fluoro-5-iodobenzonitrile |
IUPAC Name: | 3-fluoro-5-iodobenzonitrile |
Description: | 3-Fluoro-5-iodobenzonitrile (CAS# 723294-75-5) is a useful research chemical. |
Molecular Weight: | 247.01 |
Molecular Formula: | C7H3FIN |
Canonical SMILES: | C1=C(C=C(C=C1F)I)C#N |
InChI: | InChI=1S/C7H3FIN/c8-6-1-5(4-10)2-7(9)3-6/h1-3H |
InChI Key: | FCJNITIJYWQFCM-UHFFFAOYSA-N |
Boiling Point: | 250.5 °C at 760 mmHg |
Density: | 1.98 g/cm3 |
MDL: | MFCD04116468 |
LogP: | 2.30198 |
Publication Number | Title | Priority Date |
WO-2020108720-A1 | Novel tetrazine compounds for in vivo imaging | 20181130 |
EP-3887359-A1 | Novel tetrazine compounds for in vivo imaging | 20181130 |
AU-2018293752-A1 | Heterocyclylmethylidene derivatives and their use as modulators of mGluR5 receptors | 20170629 |
CA-3066193-A1 | Heterocyclylmethylidene derivatives and their use as modulators of mglur5 receptors | 20170629 |
CN-111094269-A | Heterocyclylmethylene derivatives and their use as mGluR5 receptor modulators | 20170629 |
Complexity: | 162 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 246.92942 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 246.92942 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 23.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS