3-Fluoro-4-[(trimethylsilyl)ethynyl]aniline - CAS 2146146-58-7
Catalog: |
BB016880 |
Product Name: |
3-Fluoro-4-[(trimethylsilyl)ethynyl]aniline |
CAS: |
2146146-58-7 |
Synonyms: |
3-fluoro-4-(2-trimethylsilylethynyl)aniline; 3-fluoro-4-(2-trimethylsilylethynyl)aniline |
IUPAC Name: | 3-fluoro-4-(2-trimethylsilylethynyl)aniline |
Description: | 3-Fluoro-4-[(trimethylsilyl)ethynyl]aniline (CAS# 2146146-58-7 ) is a useful research chemical. |
Molecular Weight: | 207.32 |
Molecular Formula: | C11H14FNSi |
Canonical SMILES: | C[Si](C)(C)C#CC1=C(C=C(C=C1)N)F |
InChI: | InChI=1S/C11H14FNSi/c1-14(2,3)7-6-9-4-5-10(13)8-11(9)12/h4-5,8H,13H2,1-3H3 |
InChI Key: | XIWRRRNSZSQYRI-UHFFFAOYSA-N |
LogP: | 3.21800 |
Publication Number | Title | Priority Date |
CA-3029883-A1 | Compounds and their use for reducing uric acid levels | 20160706 |
EP-3481819-A1 | Compounds and their use for reducing uric acid levels | 20160706 |
JP-2019520387-A | Compounds for reducing the amount of uric acid and their use | 20160706 |
KR-20190025612-A | Compounds for reducing uric acid levels and their use | 20160706 |
TW-201805282-A | Compounds and their use for lowering uric acid levels | 20160706 |
Complexity: | 257 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 207.08795415 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 207.08795415 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 26 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS