3-Fluoro-4-nitrobenzoyl Chloride - CAS 157665-51-5
Catalog: |
BB011342 |
Product Name: |
3-Fluoro-4-nitrobenzoyl Chloride |
CAS: |
157665-51-5 |
Synonyms: |
3-fluoro-4-nitrobenzoyl chloride; 3-fluoro-4-nitrobenzoyl chloride |
IUPAC Name: | 3-fluoro-4-nitrobenzoyl chloride |
Description: | 3-Fluoro-4-nitrobenzoyl Chloride (CAS# 157665-51-5) is used as a reactant or a reagent in various organic reactions. |
Molecular Weight: | 203.56 |
Molecular Formula: | C7H3ClFNO3 |
Canonical SMILES: | C1=CC(=C(C=C1C(=O)Cl)F)[N+](=O)[O-] |
InChI: | InChI=1S/C7H3ClFNO3/c8-7(11)4-1-2-6(10(12)13)5(9)3-4/h1-3H |
InChI Key: | DPAMLESDGWVDBW-UHFFFAOYSA-N |
LogP: | 2.63610 |
Publication Number | Title | Priority Date |
WO-2021136390-A1 | Blood coagulation factor xia inhibitor | 20191231 |
WO-2020175838-A1 | Diamine compound, and polyimide precursor and polyimide film using same | 20190228 |
CN-113166046-A | Diamine compound, and polyimide precursor and polyimide film using same | 20190228 |
KR-102267448-B1 | Diamine compound, and polyimide precursor and polyimide film prepared by using the same | 20190228 |
KR-20200105396-A | Diamine compound, and polyimide precursor and polyimide film prepared by using the same | 20190228 |
Complexity: | 230 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 202.9785488 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 202.9785488 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 62.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS