3-Fluoro-2-(hydroxymethyl)-5-(trifluoromethyl)pyridine - CAS 1227515-52-7
Catalog: |
BB005482 |
Product Name: |
3-Fluoro-2-(hydroxymethyl)-5-(trifluoromethyl)pyridine |
CAS: |
1227515-52-7 |
Synonyms: |
[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]methanol; [3-fluoro-5-(trifluoromethyl)pyridin-2-yl]methanol |
IUPAC Name: | [3-fluoro-5-(trifluoromethyl)pyridin-2-yl]methanol |
Description: | 3-Fluoro-2-(hydroxymethyl)-5-(trifluoromethyl)pyridine (CAS# 1227515-52-7) is a useful research chemical. |
Molecular Weight: | 195.11 |
Molecular Formula: | C7H5F4NO |
Canonical SMILES: | C1=C(C=NC(=C1F)CO)C(F)(F)F |
InChI: | InChI=1S/C7H5F4NO/c8-5-1-4(7(9,10)11)2-12-6(5)3-13/h1-2,13H,3H2 |
InChI Key: | GIWSPFNMLIYZKI-UHFFFAOYSA-N |
Appearance: | Liquid |
LogP: | 1.73180 |
Publication Number | Title | Priority Date |
US-10689354-B2 | Aminoazole derivative | 20151211 |
US-2019031628-A1 | Aminoazole derivative | 20151211 |
WO-2017099237-A1 | Aminoazole derivative | 20151211 |
EP-3388425-B1 | Aminoazole derivative | 20151211 |
EP-2675811-A1 | Tricyclic pyridine derivatives, medicaments containing such compounds, their use and process for their preparation | 20110217 |
Complexity: | 172 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 195.03072643 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 195.03072643 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 33.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS