3-(Ethylsulfonyl)bromobenzene - CAS 153435-82-6
Catalog: |
BB010899 |
Product Name: |
3-(Ethylsulfonyl)bromobenzene |
CAS: |
153435-82-6 |
Synonyms: |
1-bromo-3-ethylsulfonylbenzene; 1-bromo-3-ethylsulfonylbenzene |
IUPAC Name: | 1-bromo-3-ethylsulfonylbenzene |
Description: | 3-(Ethylsulfonyl)bromobenzene (CAS# 153435-82-6) is a useful research chemical. |
Molecular Weight: | 249.12 |
Molecular Formula: | C8H9BrO2S |
Canonical SMILES: | CCS(=O)(=O)C1=CC(=CC=C1)Br |
InChI: | InChI=1S/C8H9BrO2S/c1-2-12(10,11)8-5-3-4-7(9)6-8/h3-6H,2H2,1H3 |
InChI Key: | GMUBLMSOVHRKLE-UHFFFAOYSA-N |
MDL: | MFCD19982772 |
LogP: | 3.32350 |
Publication Number | Title | Priority Date |
WO-2019198024-A1 | 4-oxo-3,4-dihydroquinazoline compounds as inhibitors of human immunodeficiency virus replication | 20180411 |
EP-3774775-A1 | 4-oxo-3,4-dihydroquinazoline compounds as inhibitors of human immunodeficiency virus replication | 20180411 |
US-2021024503-A1 | 4-oxo-3,4-dihydroquinazoline compounds as inhibitors of human immunodeficiency virus replication | 20180411 |
JP-2021521131-A | 4-Oxo-3,4-dihydroquinazoline compounds as inhibitors of human immunodeficiency virus replication | 20180411 |
CN-110799490-A | Process for producing 3-arylpropionamide compound and process for producing 3-arylpropionate compound | 20170531 |
Complexity: | 230 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 247.95066 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 247.95066 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 42.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS