3-(Ethylamino)-1-methylazetidine - CAS 1434128-51-4
Catalog: |
BB009586 |
Product Name: |
3-(Ethylamino)-1-methylazetidine |
CAS: |
1434128-51-4 |
Synonyms: |
N-ethyl-1-methyl-3-azetidinamine; N-ethyl-1-methylazetidin-3-amine |
IUPAC Name: | N-ethyl-1-methylazetidin-3-amine |
Description: | 3-(Ethylamino)-1-methylazetidine (CAS# 1434128-51-4) is a useful research chemical. |
Molecular Weight: | 114.19 |
Molecular Formula: | C6H14N2 |
Canonical SMILES: | CCNC1CN(C1)C |
InChI: | InChI=1S/C6H14N2/c1-3-7-6-4-8(2)5-6/h6-7H,3-5H2,1-2H3 |
InChI Key: | TYRJTKUUMOUABY-UHFFFAOYSA-N |
Publication Number | Title | Priority Date |
US-2020148667-A1 | Substituted heterocyclic derivatives as pi3k inhibitors | 20181113 |
US-2020317642-A1 | Amine-substituted heterocyclic compounds as ehmt2 inhibitors and derivatives thereof | 20171017 |
WO-2018064557-A1 | Substituted fused bi- or tri- heterocyclic compounds as ehmt2 inhibitors | 20160930 |
US-2017355712-A1 | Amine-substituted aryl or heteroaryl compounds | 20160415 |
US-2017197945-A1 | 2-substituted quinazoline compounds comprising a substituted heterocyclic group and methods of use thereof | 20151116 |
Complexity: | 66.9 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 114.115698455 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 114.115698455 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 15.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS