3-Ethyl 3-Methyl 1-Boc-piperidine-3,3-dicarboxylate - CAS 1624302-00-6
Catalog: |
BB011874 |
Product Name: |
3-Ethyl 3-Methyl 1-Boc-piperidine-3,3-dicarboxylate |
CAS: |
1624302-00-6 |
Synonyms: |
piperidine-1,3,3-tricarboxylic acid O1-tert-butyl ester O3'-ethyl ester O3-methyl ester; 1-O-tert-butyl 3-O'-ethyl 3-O-methyl piperidine-1,3,3-tricarboxylate |
IUPAC Name: | 1-O-tert-butyl 3-O'-ethyl 3-O-methyl piperidine-1,3,3-tricarboxylate |
Description: | 3-Ethyl 3-Methyl 1-Boc-piperidine-3,3-dicarboxylate (CAS# 1624302-00-6 ) is a useful research chemical. |
Molecular Weight: | 315.36 |
Molecular Formula: | C15H25NO6 |
Canonical SMILES: | CCOC(=O)C1(CCCN(C1)C(=O)OC(C)(C)C)C(=O)OC |
InChI: | InChI=1S/C15H25NO6/c1-6-21-12(18)15(11(17)20-5)8-7-9-16(10-15)13(19)22-14(2,3)4/h6-10H2,1-5H3 |
InChI Key: | DGZNMZANSOFJFJ-UHFFFAOYSA-N |
Publication Number | Title | Priority Date |
AU-2014221726-A1 | 2-acylaminothiazole derivative or salt thereof | 20130228 |
AU-2014221726-B2 | 2-acylaminothiazole derivative or salt thereof | 20130228 |
CA-2902302-A1 | 2-acylaminothiazole derivative or salt thereof | 20130228 |
EP-2963036-A1 | 2-acylaminothiazole derivative and salt thereof | 20130228 |
EP-2963036-B1 | 2-acylaminothiazole derivative and salt thereof | 20130228 |
Complexity: | 442 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 315.16818752 |
Formal Charge: | 0 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 315.16818752 |
Rotatable Bond Count: | 7 |
Topological Polar Surface Area: | 82.1 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS