3-Ethoxy-2-cyclohexenone - CAS 5323-87-5
Catalog: |
BB028094 |
Product Name: |
3-Ethoxy-2-cyclohexenone |
CAS: |
5323-87-5 |
Synonyms: |
3-ethoxycyclohex-2-en-1-one |
IUPAC Name: | 3-ethoxycyclohex-2-en-1-one |
Description: | 3-Ethoxy-2-cyclohexenone (CAS# 5323-87-5) is a useful research chemical. |
Molecular Weight: | 140.18 |
Molecular Formula: | C8H12O2 |
Canonical SMILES: | CCOC1=CC(=O)CCC1 |
InChI: | InChI=1S/C8H12O2/c1-2-10-8-5-3-4-7(9)6-8/h6H,2-5H2,1H3 |
InChI Key: | JWCFJPLIRVYENQ-UHFFFAOYSA-N |
Boiling Point: | 76-78 °C (1 torr) |
Density: | 1.04 g/cm3 |
MDL: | MFCD00001580 |
LogP: | 1.65980 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021093758-A1 | Pyrimido derivative and application thereof in medicine | 20191115 |
US-2020347066-A1 | Tricyclic amine compounds as cdk2 inhibitors | 20190501 |
US-2020347067-A1 | Tricyclic amine compounds as cdk2 inhibitors | 20190501 |
WO-2020223469-A1 | N-(1-(methylsulfonyl)piperidin-4-yl)-4,5-di hydro-1h-imidazo[4,5-h]quinazolin-8-amine derivatives and related compounds as cyclin-dependent kinase 2 (cdk2) inhibitors for treating cancer | 20190501 |
WO-2020223558-A1 | Tricyclic amine compounds as cdk2 inhibitors | 20190501 |
PMID | Publication Date | Title | Journal |
22169867 | 20111106 | Scalable enantioselective total synthesis of taxanes | Nature chemistry |
Complexity: | 159 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 140.083729621 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 140.083729621 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 26.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS