3-(Dimethylamino)-1-(4-fluorophenyl)-2-propen-1-one - CAS 75175-77-8
Catalog: |
BB035259 |
Product Name: |
3-(Dimethylamino)-1-(4-fluorophenyl)-2-propen-1-one |
CAS: |
75175-77-8 |
Synonyms: |
(E)-3-(dimethylamino)-1-(4-fluorophenyl)-2-propen-1-one; (E)-3-(dimethylamino)-1-(4-fluorophenyl)prop-2-en-1-one |
IUPAC Name: | (E)-3-(dimethylamino)-1-(4-fluorophenyl)prop-2-en-1-one |
Description: | 3-(Dimethylamino)-1-(4-fluorophenyl)-2-propen-1-one (CAS# 75175-77-8) is a useful research chemical. |
Molecular Weight: | 193.22 |
Molecular Formula: | C11H12FNO |
Canonical SMILES: | CN(C)C=CC(=O)C1=CC=C(C=C1)F |
InChI: | InChI=1S/C11H12FNO/c1-13(2)8-7-11(14)9-3-5-10(12)6-4-9/h3-8H,1-2H3/b8-7+ |
InChI Key: | GTJNUCRUOWBWEW-BQYQJAHWSA-N |
MDL: | MFCD00111509 |
LogP: | 2.08370 |
Publication Number | Title | Priority Date |
WO-2021113363-A1 | Sstr5 antagonists | 20191203 |
WO-2020250183-A1 | Fused heterocyclic compounds and their use as pest control agents | 20190613 |
WO-2020135210-A1 | Substituted aryl compound and preparation method therefor and use thereof | 20181228 |
AU-2017229129-A1 | Thiazolidinone compounds and use thereof | 20160307 |
EP-3426246-A1 | Thiazolidinone compounds and use thereof | 20160307 |
Complexity: | 217 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 1 |
Exact Mass: | 193.090292168 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 193.090292168 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 20.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS