3-(Difluoromethoxy)nitrobenzene - CAS 22236-07-3
Catalog: |
BB017463 |
Product Name: |
3-(Difluoromethoxy)nitrobenzene |
CAS: |
22236-07-3 |
Synonyms: |
1-(difluoromethoxy)-3-nitrobenzene |
IUPAC Name: | 1-(difluoromethoxy)-3-nitrobenzene |
Description: | 3-(Difluoromethoxy)nitrobenzene can be used to prepare as glucan synthase inhibitors. |
Molecular Weight: | 189.12 |
Molecular Formula: | C7H5F2NO3 |
Canonical SMILES: | C1=CC(=CC(=C1)OC(F)F)[N+](=O)[O-] |
InChI: | InChI=1S/C7H5F2NO3/c8-7(9)13-6-3-1-2-5(4-6)10(11)12/h1-4,7H |
InChI Key: | NYVCZALWNPMMSQ-UHFFFAOYSA-N |
Boiling Point: | 240 °C |
Purity: | 95 % |
Density: | 1.391 g/mL at 25 °C (lit.) |
MDL: | MFCD03407974 |
LogP: | 2.71940 |
GHS Hazard Statement: | H302 (11.63%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-113072539-A | Chemical synthesis method of pantoprazole dimer | 20210329 |
CN-109071505-A | Kinase inhibitor | 20160406 |
BR-PI0909104-A2 | chemical compounds | 20080304 |
TW-200307686-A | Pharmaceutical combination | 20020531 |
DE-69634479-T2 | Process for the preparation of aryl difluoromethyl ethers | 19950131 |
Complexity: | 183 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 189.02374935 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 189.02374935 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 55 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS