3-Cyanobenzenesulfonyl chloride - CAS 56542-67-7
Catalog: |
BB029396 |
Product Name: |
3-Cyanobenzenesulfonyl chloride |
CAS: |
56542-67-7 |
Synonyms: |
3-cyanobenzenesulfonyl chloride |
IUPAC Name: | 3-cyanobenzenesulfonyl chloride |
Description: | A benzenesulfonamide derivative as potential kinase inhibitors. |
Molecular Weight: | 201.63 |
Molecular Formula: | C7H4ClNO2S |
Canonical SMILES: | C1=CC(=CC(=C1)S(=O)(=O)Cl)C#N |
InChI: | InChI=1S/C7H4ClNO2S/c8-12(10,11)7-3-1-2-6(4-7)5-9/h1-4H |
InChI Key: | BHNRGBRMCNHNQD-UHFFFAOYSA-N |
Boiling Point: | 148 °C (3 mmHg) |
Melting Point: | 49-53 °C |
Purity: | 95 % |
Density: | 1.53 g/cm3 |
MDL: | MFCD00203480 |
LogP: | 2.56658 |
GHS Hazard Statement: | H302 (13.04%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P260, P261, P264, P270, P272, P280, P301+P312, P301+P330+P331, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P330, P333+P313, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
EP-3896521-A1 | Polymer, photosensitive resin composition, patterning method, method of forming cured film, interlayer insulating film, surface protective film, and electronic component | 20200414 |
US-2021317268-A1 | Polymer, photosensitive resin composition, patterning method, method of forming cured film, interlayer insulating film, surface protective film, and electronic component | 20200414 |
WO-2021123237-A1 | 2-amino-n-(amino-oxo-aryl-lambda6-sulfanylidene)acetamide compounds and their therapeutic use | 20191219 |
CN-112759536-A | Process for the preparation of substituted benzene sulfonyl chlorides | 20191105 |
WO-2021005586-A1 | Tricyclic akr1c3 dependent kars inhibitors | 20190801 |
Complexity: | 297 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 200.9651272 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 200.9651272 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 66.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Sulfur Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS