3-Chloroquinoline-2-carbaldehyde - CAS 1169394-26-6
Catalog: |
BB003821 |
Product Name: |
3-Chloroquinoline-2-carbaldehyde |
CAS: |
1169394-26-6 |
Synonyms: |
3-chloro-2-quinolinecarboxaldehyde; 3-chloroquinoline-2-carbaldehyde |
IUPAC Name: | 3-chloroquinoline-2-carbaldehyde |
Description: | 3-Chloroquinoline-2-carbaldehyde (CAS# 1169394-26-6) is a useful research chemical. |
Molecular Weight: | 191.61 |
Molecular Formula: | C10H6ClNO |
Canonical SMILES: | C1=CC=C2C(=C1)C=C(C(=N2)C=O)Cl |
InChI: | InChI=1S/C10H6ClNO/c11-8-5-7-3-1-2-4-9(7)12-10(8)6-13/h1-6H |
InChI Key: | VCQLLYQRRZEZSL-UHFFFAOYSA-N |
LogP: | 2.70070 |
Publication Number | Title | Priority Date |
JP-2019104716-A | Organometallic iridium complex, synthesis method thereof and organic light emitting device using the same | 20171211 |
TW-201819396-A | Organometallic ruthenium complex and simple synthesis method and use thereof | 20171211 |
TW-I650325-B | Organometallic ruthenium complex and simple synthesis method and use thereof | 20171211 |
WO-2014207213-A1 | Novel inhibitors of protein kinase c epsilon signaling | 20130628 |
CA-2754237-A1 | Cyanoquinoline compounds having activity in correcting mutant-cftr processing and increasing ion transport and uses thereof | 20110527 |
Complexity: | 197 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 191.0137915 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 191.0137915 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 30 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS