3-Chlorophenyl Methyl Sulfone - CAS 21383-00-6
Catalog: |
BB016810 |
Product Name: |
3-Chlorophenyl Methyl Sulfone |
CAS: |
21383-00-6 |
Synonyms: |
1-chloro-3-methylsulfonylbenzene; 1-chloro-3-methylsulfonylbenzene |
IUPAC Name: | 1-chloro-3-methylsulfonylbenzene |
Description: | 3-Chlorophenyl Methyl Sulfone (CAS# 21383-00-6) is a useful research chemical. |
Molecular Weight: | 190.65 |
Molecular Formula: | C7H7ClO2S |
Canonical SMILES: | CS(=O)(=O)C1=CC(=CC=C1)Cl |
InChI: | InChI=1S/C7H7ClO2S/c1-11(9,10)7-4-2-3-6(8)5-7/h2-5H,1H3 |
InChI Key: | BWPZAUWSFKCBNG-UHFFFAOYSA-N |
LogP: | 2.82430 |
Publication Number | Title | Priority Date |
CN-110799490-A | Process for producing 3-arylpropionamide compound and process for producing 3-arylpropionate compound | 20170531 |
EP-3632892-A1 | Method for producing 3-arylpropionamide compound and 3-arylpropionic acid ester compound | 20170531 |
KR-20200014305-A | Process for preparing 3-aryl propion amide compound and 3-aryl propionic acid ester compound | 20170531 |
US-2020165209-A1 | Method for producing 3-arylpropionamide compound and 3-arylpropionic acid ester compound | 20170531 |
US-11028056-B2 | Method for producing 3-arylpropionamide compound and 3-arylpropionic acid ester compound | 20170531 |
Complexity: | 217 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 189.9855283 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 189.9855283 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 42.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Sulfur Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS