3-(Chloromethyl)-5-fluoropyridine Hydrochloride - CAS 1222556-83-3
Catalog: |
BB005383 |
Product Name: |
3-(Chloromethyl)-5-fluoropyridine Hydrochloride |
CAS: |
1222556-83-3 |
Synonyms: |
3-(chloromethyl)-5-fluoropyridine;hydrochloride; 3-(chloromethyl)-5-fluoropyridine;hydrochloride |
IUPAC Name: | 3-(chloromethyl)-5-fluoropyridine;hydrochloride |
Description: | 3-(Chloromethyl)-5-fluoropyridine Hydrochloride (CAS# 1222556-83-3) is a useful research chemical. |
Molecular Weight: | 182.02 |
Molecular Formula: | C6H6Cl2FN |
Canonical SMILES: | C1=C(C=NC=C1F)CCl.Cl |
InChI: | InChI=1S/C6H5ClFN.ClH/c7-2-5-1-6(8)4-9-3-5;/h1,3-4H,2H2;1H |
InChI Key: | PFOZTYJEKXOWQS-UHFFFAOYSA-N |
Storage: | Inert atmosphere, 2-8 °C |
Publication Number | Title | Priority Date |
US-2020392113-A1 | Substituted pyrazolo-pyrazines and their use as glun2b receptor modulators | 20190614 |
WO-2020249785-A1 | Substituted heteroaromatic pyrazolo-pyridines and their use as glun2b receptor modulators | 20190614 |
WO-2020249802-A1 | Substituted pyrazolo-pyrazines and their use as glun2b receptor modulators | 20190614 |
US-2021017169-A1 | Substituted heteroaromatic pyrazolo-pyridines and their use as glun2b receptor modulators | 20190614 |
WO-2020247804-A1 | Heterocycle substituted pyridine derivative antifungal agents | 20190607 |
Complexity: | 89.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 180.9861327 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 180.9861327 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 12.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS