3-Chloro-6-nitro-1H-indazole - CAS 50593-68-5
Catalog: |
BB027124 |
Product Name: |
3-Chloro-6-nitro-1H-indazole |
CAS: |
50593-68-5 |
Synonyms: |
3-chloro-6-nitro-2H-indazole; 3-chloro-6-nitro-2H-indazole |
IUPAC Name: | 3-chloro-6-nitro-2H-indazole |
Description: | 3-Chloro-6-nitro-1H-indazole (CAS# 50593-68-5) is a useful research chemical. |
Molecular Weight: | 197.58 |
Molecular Formula: | C7H4ClN3O2 |
Canonical SMILES: | C1=CC2=C(NN=C2C=C1[N+](=O)[O-])Cl |
InChI: | InChI=1S/C7H4ClN3O2/c8-7-5-2-1-4(11(12)13)3-6(5)9-10-7/h1-3H,(H,9,10) |
InChI Key: | IBTQINLHMGQUJU-UHFFFAOYSA-N |
Boiling Point: | 234.7 °C at 760 mmHg |
Density: | 1.661 g/cm3 |
MDL: | MFCD00010741 |
LogP: | 2.64770 |
Publication Number | Title | Priority Date |
CA-3061609-A1 | Method for producing difluoromethylene compound | 20170428 |
EP-3617197-A1 | Method for producing difluoromethylene compound | 20170428 |
JP-WO2018199284-A1 | Method for producing difluoromethylene compound | 20170428 |
KR-20190141752-A | Preparation of Difluoromethylene Compound | 20170428 |
TW-201843141-A | Method for producing difluoromethane compound | 20170428 |
PMID | Publication Date | Title | Journal |
19679481 | 20090901 | Fluorinated indazoles as novel selective inhibitors of nitric oxide synthase (NOS): synthesis and biological evaluation | Bioorganic & medicinal chemistry |
Complexity: | 220 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 196.9992041 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 196.9992041 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 74.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Indazoles
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS