3-Chloro-5-ethoxy-4-hydroxybenzaldehyde - CAS 70842-33-0
Catalog: |
BB034252 |
Product Name: |
3-Chloro-5-ethoxy-4-hydroxybenzaldehyde |
CAS: |
70842-33-0 |
Synonyms: |
3-chloro-5-ethoxy-4-hydroxybenzaldehyde; 3-chloro-5-ethoxy-4-hydroxybenzaldehyde |
IUPAC Name: | 3-chloro-5-ethoxy-4-hydroxybenzaldehyde |
Description: | 3-Chloro-5-ethoxy-4-hydroxybenzaldehyde (CAS# 70842-33-0) is a useful research chemical. |
Molecular Weight: | 200.62 |
Molecular Formula: | C9H9ClO3 |
Canonical SMILES: | CCOC1=C(C(=CC(=C1)C=O)Cl)O |
InChI: | InChI=1S/C9H9ClO3/c1-2-13-8-4-6(5-11)3-7(10)9(8)12/h3-5,12H,2H2,1H3 |
InChI Key: | HXWPHQVLVFUYLR-UHFFFAOYSA-N |
Boiling Point: | 301.8 °C at 760 mmHg |
Density: | 1.319 g/cm3 |
LogP: | 2.25680 |
Publication Number | Title | Priority Date |
EP-2970331-A1 | Spiro azetidine isoxazole derivatives and their use as sstr5 antagonists | 20130314 |
EP-2970331-B1 | Spiro azetidine isoxazole derivatives and their use as sstr5 antagonists | 20130314 |
ES-2629729-T3 | Spiro azetidine asoxazol derivatives and their use as sstr5 antagonists | 20130314 |
JP-2016510719-A | Spiroazetidine isoxazole derivatives and their use as SSTR5 antagonists | 20130314 |
JP-6247697-B2 | Spiroazetidine isoxazole derivatives and their use as SSTR5 antagonists | 20130314 |
Complexity: | 174 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 200.0240218 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 200.0240218 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 46.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS