3-Chloro-4-pyrrolidin-1-ylbenzoic acid - CAS 585517-09-5
Catalog: |
BB030081 |
Product Name: |
3-Chloro-4-pyrrolidin-1-ylbenzoic acid |
CAS: |
585517-09-5 |
Synonyms: |
3-chloro-4-pyrrolidin-1-ylbenzoic acid |
IUPAC Name: | 3-chloro-4-pyrrolidin-1-ylbenzoic acid |
Description: | 3-Chloro-4-pyrrolidin-1-ylbenzoic acid (CAS# 585517-09-5) is a useful research chemical. |
Molecular Weight: | 225.67 |
Molecular Formula: | C11H12ClNO2 |
Canonical SMILES: | C1CCN(C1)C2=C(C=C(C=C2)C(=O)O)Cl |
InChI: | InChI=1S/C11H12ClNO2/c12-9-7-8(11(14)15)3-4-10(9)13-5-1-2-6-13/h3-4,7H,1-2,5-6H2,(H,14,15) |
InChI Key: | ICTYJBKSXOEFEB-UHFFFAOYSA-N |
Boiling Point: | 396.4 °C at 760 mmHg |
Density: | 1.339 g/cm3 |
MDL: | MFCD02628415 |
LogP: | 2.70340 |
Publication Number | Title | Priority Date |
TW-201922728-A | Novel heterocyclic compounds | 20171010 |
US-2020299277-A1 | Piperazine derivatives as magl inhibitors | 20171010 |
AU-2018246563-A1 | 4-Pyridone compound or salt thereof, and pharmaceutical composition and formulation including same | 20170331 |
BR-112019020401-A2 | 4-pyridone compound or its salt, and pharmaceutical composition and formulation that includes the same | 20170331 |
CN-110475775-A | 4- pyridinone compounds or its salt, pharmaceutical composition and agent comprising 4- pyridinone compounds | 20170331 |
Complexity: | 241 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 225.0556563 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 225.0556563 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 40.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Pyrrolidines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS