3-Chloro-4-morpholinobenzaldehyde - CAS 886500-23-8
Catalog: |
BB039110 |
Product Name: |
3-Chloro-4-morpholinobenzaldehyde |
CAS: |
886500-23-8 |
Synonyms: |
3-chloro-4-(4-morpholinyl)benzaldehyde; 3-chloro-4-morpholin-4-ylbenzaldehyde |
IUPAC Name: | 3-chloro-4-morpholin-4-ylbenzaldehyde |
Description: | 3-Chloro-4-morpholinobenzaldehyde (CAS# 886500-23-8) is a useful research chemical. |
Molecular Weight: | 225.67 |
Molecular Formula: | C11H12ClNO2 |
Canonical SMILES: | C1COCCN1C2=C(C=C(C=C2)C=O)Cl |
InChI: | InChI=1S/C11H12ClNO2/c12-10-7-9(8-14)1-2-11(10)13-3-5-15-6-4-13/h1-2,7-8H,3-6H2 |
InChI Key: | PUYGMNZNDICVPO-UHFFFAOYSA-N |
LogP: | 2.05410 |
Publication Number | Title | Priority Date |
EP-3455226-A1 | Spirocycle compounds and methods of making and using same | 20160512 |
US-10030020-B2 | Spirocycle compounds and methods of making and using same | 20160512 |
US-2017327500-A1 | Spirocycle compounds and methods of making and using same | 20160512 |
US-2020022977-A1 | Spirocycle compounds and methods of making and using same | 20160512 |
WO-2017197192-A1 | Spirocycle compounds and methods of making and using same | 20160512 |
Complexity: | 219 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 225.0556563 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 225.0556563 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 29.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS