3-Chloro-4-methoxybenzyl alcohol - CAS 14503-45-8
Catalog: |
BB009863 |
Product Name: |
3-Chloro-4-methoxybenzyl alcohol |
CAS: |
14503-45-8 |
Synonyms: |
(3-chloro-4-methoxyphenyl)methanol |
IUPAC Name: | (3-chloro-4-methoxyphenyl)methanol |
Description: | 3-Chloro-4-methoxybenzyl alcohol (CAS# 14503-45-8) is a useful research chemical. |
Molecular Weight: | 172.61 |
Molecular Formula: | C8H9ClO2 |
Canonical SMILES: | COC1=C(C=C(C=C1)CO)Cl |
InChI: | InChI=1S/C8H9ClO2/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4,10H,5H2,1H3 |
InChI Key: | TZHJVLGDHRXGDX-UHFFFAOYSA-N |
Boiling Point: | 279.7 °C at 760 mmHg |
Density: | 1.239 g/cm3 |
Appearance: | Liquid |
LogP: | 1.84090 |
GHS Hazard Statement: | H302 (97.44%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P280, P301+P312, P305+P351+P338, P330, P337+P313, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021130492-A1 | Carboxy derivatives with antiinflammatory properties | 20191223 |
WO-2020127463-A1 | Polyacrylate polymer | 20181220 |
CN-113195564-A | Polyacrylate polymers | 20181220 |
EP-3898730-A1 | Polyacrylate polymer | 20181220 |
EP-3350191-A1 | Nucleotide analogs | 20150915 |
Complexity: | 119 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 172.0291072 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 172.0291072 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 29.5 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Oxygen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS