3-Chloro-2-methylanisole - CAS 3260-88-6
Catalog: |
BB021346 |
Product Name: |
3-Chloro-2-methylanisole |
CAS: |
3260-88-6 |
Synonyms: |
1-chloro-3-methoxy-2-methylbenzene |
IUPAC Name: | 1-chloro-3-methoxy-2-methylbenzene |
Description: | 3-Chloro-2-methylanisole (CAS# 3260-88-6) is a useful research chemical compound. |
Molecular Weight: | 156.61 |
Molecular Formula: | C8H9ClO |
Canonical SMILES: | CC1=C(C=CC=C1Cl)OC |
InChI: | InChI=1S/C8H9ClO/c1-6-7(9)4-3-5-8(6)10-2/h3-5H,1-2H3 |
InChI Key: | LTVRGAWOEOKGJZ-UHFFFAOYSA-N |
Boiling Point: | 213-217 °C (lit.) |
Melting Point: | -3 °C |
Purity: | 95 % |
Density: | 1.16 g/cm3 |
Appearance: | Liquid |
MDL: | MFCD00070772 |
LogP: | 2.65700 |
GHS Hazard Statement: | H226 (100%): Flammable liquid and vapor [Warning Flammable liquids] |
Precautionary Statement: | P210, P233, P240, P241, P242, P243, P280, P303+P361+P353, P370+P378, P403+P235, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-113248351-A | Preparation method of 6-chloro-2-methoxytoluene and synthetic process of methoxyfenozide | 20210526 |
CN-111018693-A | 2-methyl-3-methoxybenzoic acid and preparation method thereof | 20200102 |
CN-112409263-A | Substituted benzoyl compound and application thereof | 20190823 |
WO-2021036845-A1 | Substituted benzoyl compound and application thereof | 20190823 |
CN-112409226-A | Substituted benzoyl compound and application thereof | 20190823 |
Complexity: | 105 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 156.0341926 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 156.0341926 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 9.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Oxygen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS