3-Chloro-1-methyl-4-nitro-1H-pyrazole - CAS 299930-70-4
Catalog: |
BB020407 |
Product Name: |
3-Chloro-1-methyl-4-nitro-1H-pyrazole |
CAS: |
299930-70-4 |
Synonyms: |
3-chloro-1-methyl-4-nitropyrazole; 3-chloro-1-methyl-4-nitropyrazole |
IUPAC Name: | 3-chloro-1-methyl-4-nitropyrazole |
Description: | 3-Chloro-1-methyl-4-nitro-1H-pyrazole (CAS# 299930-70-4 ) is a useful research chemical. |
Molecular Weight: | 161.55 |
Molecular Formula: | C4H4ClN3O2 |
Canonical SMILES: | CN1C=C(C(=N1)Cl)[N+](=O)[O-] |
InChI: | InChI=1S/C4H4ClN3O2/c1-7-2-3(8(9)10)4(5)6-7/h2H,1H3 |
InChI Key: | UEDIAFCRVLLBSS-UHFFFAOYSA-N |
LogP: | 1.50490 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021062327-A1 | Fused pyrimidine compounds, compositions and medicinal applications thereof | 20190927 |
CN-109641882-A | Heteroaromatic derivative as NIK inhibitor | 20160630 |
EP-3476848-A1 | Benzofuran pyrazole amine protein kinase inhibitor | 20160627 |
JP-2019520382-A | Benzofuran pyrazole amines protein kinase inhibitors | 20160627 |
US-2019225600-A1 | Benzofuran pyrazole amine kinase inhibitor | 20160627 |
Complexity: | 148 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 160.9992041 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 160.9992041 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 63.6 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyrazoles
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS