3-Bromoperylene - CAS 23683-68-3
Catalog: |
BB018140 |
Product Name: |
3-Bromoperylene |
CAS: |
23683-68-3 |
Synonyms: |
3-bromoperylene; 3-bromoperylene |
IUPAC Name: | 3-bromoperylene |
Description: | 3-Bromoperylene (CAS# 23683-68-3) is a useful research chemical. |
Molecular Weight: | 331.21 |
Molecular Formula: | C20H11Br |
Canonical SMILES: | C1=CC2=C3C(=C1)C4=C5C(=CC=C4)C(=CC=C5C3=CC=C2)Br |
InChI: | InChI=1S/C20H11Br/c21-18-11-10-16-14-7-2-5-12-4-1-6-13(19(12)14)15-8-3-9-17(18)20(15)16/h1-11H |
InChI Key: | GPBMCEWKAPSTOU-UHFFFAOYSA-N |
MDL: | MFCD12024274 |
LogP: | 6.49970 |
Publication Number | Title | Priority Date |
CN-112194563-A | Compound containing perylene and fluorobenzene and preparation method and application thereof | 20201029 |
WO-2021132373-A1 | Rare earth complex | 20191225 |
EP-3816238-A1 | Polyparaperylene derivatives and methods for making same | 20191104 |
CN-111410967-A | Circular polarization luminous chiral nematic liquid crystal material and preparation method and application thereof | 20190108 |
CN-109232421-B | Perylene monoimide peri-fused fullerene derivative and preparation method and application thereof | 20180920 |
PMID | Publication Date | Title | Journal |
20860362 | 20101018 | Highly fluorescent platinum(II) organometallic complexes of perylene and perylene monoimide, with Pt σ-bonded directly to the perylene core | Inorganic chemistry |
18930403 | 20081115 | Perylene-conjugated pyrrole polyamide as a sequence-specific fluorescent probe | Bioorganic & medicinal chemistry |
Complexity: | 405 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 330.00441 |
Formal Charge: | 0 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 0 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 330.00441 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 0 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 6.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Arenes
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS