3-bromomethyl-3-methyloxetane - CAS 78385-26-9
Catalog: |
BB036159 |
Product Name: |
3-bromomethyl-3-methyloxetane |
CAS: |
78385-26-9 |
Synonyms: |
3-(bromomethyl)-3-methyloxetane; 3-(bromomethyl)-3-methyloxetane |
IUPAC Name: | 3-(bromomethyl)-3-methyloxetane |
Description: | 3-bromomethyl-3-methyloxetane (CAS# 78385-26-9) is a monomer for the synthesis of Poly 3-bromomethyl-3-Me oxetane (PolyBrMMO), an energetic thermoplastic elastomer for propellant formulations. |
Molecular Weight: | 165.03 |
Molecular Formula: | C5H9BrO |
Canonical SMILES: | CC1(COC1)CBr |
InChI: | InChI=1S/C5H9BrO/c1-5(2-6)3-7-4-5/h2-4H2,1H3 |
InChI Key: | MGBZKWOJRYGRTO-UHFFFAOYSA-N |
Boiling Point: | 162 ℃ at 760 mmHg |
Purity: | 97.0 % |
Density: | 1.438 g/cm3 |
Appearance: | Liquid |
MDL: | MFCD02684290 |
LogP: | 1.41780 |
GHS Hazard Statement: | H302 (95.12%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P301+P312, P330, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-112851837-A | Safe and efficient preparation method of high-azide-content polymer | 20210226 |
WO-2021163727-A1 | Pikfyve kinase inhibitors | 20200211 |
WO-2021105960-A1 | Substituted tricyclic compounds | 20191129 |
US-2021130365-A1 | 2-azaspiro[3.4]octane derivatives as m4 agonists | 20191009 |
WO-2021070091-A1 | 5-oxa-2-azaspiro[3.4]octane derivatives as m4 agonists | 20191009 |
Complexity: | 68.5 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 163.98368 |
Formal Charge: | 0 |
Heavy Atom Count: | 7 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 163.98368 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 9.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Oxetane/Thietane
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS