3-Bromobenzylamine - CAS 10269-01-9
Catalog: |
BB000916 |
Product Name: |
3-Bromobenzylamine |
CAS: |
10269-01-9 |
Synonyms: |
(3-bromophenyl)methanamine; (3-bromophenyl)methanamine |
IUPAC Name: | (3-bromophenyl)methanamine |
Description: | 3-Bromobenzylamine (CAS# 10269-01-9) is a useful research chemical. |
Molecular Weight: | 186.05 |
Molecular Formula: | C7H8BrN |
Canonical SMILES: | C1=CC(=CC(=C1)Br)CN |
InChI: | InChI=1S/C7H8BrN/c8-7-3-1-2-6(4-7)5-9/h1-4H,5,9H2 |
InChI Key: | SUYJXERPRICYRX-UHFFFAOYSA-N |
Boiling Point: | 244.5 °C at 760 mmHg |
Density: | 1.481 g/cm3 |
MDL: | MFCD01026119 |
LogP: | 2.60810 |
GHS Hazard Statement: | H314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] |
Precautionary Statement: | P260, P264, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-113292510-A | Benzisothiazole compound for inhibiting hypoxia inducible factor 2 activity, preparation method and application thereof | 20210607 |
CN-112592318-A | 2- (4-methionyl) anilino-4-aminopyrimidine derivatives and application thereof | 20201212 |
CN-111875515-A | Method for generating amide by catalyzing primary amine with metal complex | 20200904 |
CN-111635334-A | Method for generating nitrile by catalyzing primary amine acceptor-free dehydrogenation through Ru complex | 20200713 |
CN-111704575-A | Method for synthesizing quinoline-2-thiocarbamide compound under conditions of no catalyst and no additive | 20200708 |
PMID | Publication Date | Title | Journal |
17206842 | 20070101 | Selective nucleophilic chemistry in the synthesis of 5-carbamoyl-3-sulfanylmethylisoxazole-4-carboxylic acids | Journal of combinatorial chemistry |
6433022 | 19840901 | Benzylamines: synthesis and evaluation of antimycobacterial properties | Journal of medicinal chemistry |
Complexity: | 85 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 184.98401 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 184.98401 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 26 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS