3-Bromobenzoyl chloride - CAS 1711-09-7
Catalog: |
BB012720 |
Product Name: |
3-Bromobenzoyl chloride |
CAS: |
1711-09-7 |
Synonyms: |
3-bromobenzoyl chloride |
IUPAC Name: | 3-bromobenzoyl chloride |
Description: | 3-Bromobenzoyl chloride (CAS# 1711-09-7) is an organic building block used in the synthesis of various chemical compounds. |
Molecular Weight: | 219.46 |
Molecular Formula: | C7H4BrClO |
Canonical SMILES: | C1=CC(=CC(=C1)Br)C(=O)Cl |
InChI: | InChI=1S/C7H4BrClO/c8-6-3-1-2-5(4-6)7(9)10/h1-4H |
InChI Key: | PBOOZQFGWNZNQE-UHFFFAOYSA-N |
Boiling Point: | 74-75 ℃ (0.5 mmHg) |
Density: | 1.662 g/cm3 |
Appearance: | Colorless to yellow liquid |
MDL: | MFCD00000669 |
LogP: | 2.82810 |
GHS Hazard Statement: | H314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] |
Precautionary Statement: | P260, P264, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-113061098-A | Amide compound and derivative thereof, preparation method, pharmaceutical composition and application | 20210118 |
CN-112480073-A | Synthesis method of 1-alkyl-3, 5-aryl substituted 1,2,4 triazole compound | 20201202 |
CN-112194670-A | Organic compound and organic electroluminescent device using same | 20200918 |
CN-112047917-A | Xanthohumol derivative and preparation method and application thereof | 20200912 |
US-2021323919-A1 | S6k1 protein kinase inhibitors as cancer therapeutics | 20200417 |
Complexity: | 138 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 217.91341 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 217.91341 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 17.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS