3-Bromobenzothiophene-2-carboxaldehyde - CAS 10135-00-9
Catalog: |
BB000489 |
Product Name: |
3-Bromobenzothiophene-2-carboxaldehyde |
CAS: |
10135-00-9 |
Synonyms: |
3-bromo-1-benzothiophene-2-carbaldehyde |
IUPAC Name: | 3-bromo-1-benzothiophene-2-carbaldehyde |
Description: | 3-Bromobenzothiophene-2-carboxaldehyde (CAS# 10135-00-9) is a useful research chemical. |
Molecular Weight: | 241.10 |
Molecular Formula: | C9H5BrOS |
Canonical SMILES: | C1=CC=C2C(=C1)C(=C(S2)C=O)Br |
InChI: | InChI=1S/C9H5BrOS/c10-9-6-3-1-2-4-7(6)12-8(9)5-11/h1-5H |
InChI Key: | GQUZXULTSUGIRF-UHFFFAOYSA-N |
Boiling Point: | 351.345 ℃ at 760 mmHg |
Melting Point: | 117-121 ℃ |
Purity: | 95 % |
Density: | 1.711 g/cm3 |
MDL: | MFCD00465001 |
LogP: | 3.47630 |
GHS Hazard Statement: | H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P280, P301+P310, P305+P351+P338, P321, P330, P337+P313, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
KR-20210076428-A | Compound, Organic EL Device and Display Device | 20191216 |
WO-2021125622-A1 | Compound, organic electroluminescent element, and display device | 20191216 |
EP-3328846-A1 | Novel compounds exhibiting photophysical properties upon formation of lewis acid-base adducts using non-chelating boranes, method for producing the same and devices including the same | 20150729 |
WO-2017016653-A1 | Novel compounds exhibiting photophysical properties upon formation of lewis acid-base adducts using non-chelating boranes, method for producing the same and devices including the same | 20150729 |
US-2015361332-A1 | Robust photochromic compounds with silicon- or phosphorus-containing heterocyclic ring and the production thereof | 20140613 |
Complexity: | 185 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 239.92445 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 239.92445 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 45.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS